C40H44O6 — CID 22168382
2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]-2,6-dimethylphenoxy]methyl]oxirane (PubChem CID 22168382) has the molecular formula C40H44O6 and a molecular weight of 620.79 g/mol. Its IUPAC name is 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]-2,6-dimethylphenoxy]methyl]oxirane.
| Compound Name | 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]-2,6-dimethylphenoxy]methyl]oxirane |
|---|---|
| PubChem CID | 22168382 |
| Molecular Formula | C40H44O6 |
| Molecular Weight | 620.79 g/mol |
| Exact Mass | 620.31 |
| IUPAC Name | 2-[[4-[2-[4-[1,1-bis[4-(oxiran-2-ylmethoxy)phenyl]ethyl]phenyl]propan-2-yl]-2,6-dimethylphenoxy]methyl]oxirane |
| SMILES | Cc1cc(C(C)(C)c2ccc(C(C)(c3ccc(OCC4CO4)cc3)c3ccc(OCC4CO4)cc3)cc2)cc(C)c1OCC1CO1 |
| InChI | InChI=1S/C40H44O6/c1-26-18-32(19-27(2)38(26)46-25-37-24-45-37)39(3,4)28-6-8-29(9-7-28)40(5,30-10-14-33(15-11-30)41-20-35-22-43-35)31-12-16-34(17-13-31)42-21-36-23-44-36/h6-19,35-37H,20-25H2,1-5H3 |
| InChIKey | YIRDCSXAPXAHJE-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.79 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|