C47H60O7 — CID 58330220
1,3-bis[4-[2-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2,6-dimethylphenoxy]propan-2-ol (PubChem CID 58330220) has the molecular formula C47H60O7 and a molecular weight of 736.99 g/mol. Its IUPAC name is 1,3-bis[4-[2-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2,6-dimethylphenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[2-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2,6-dimethylphenoxy]propan-2-ol |
|---|---|
| PubChem CID | 58330220 |
| Molecular Formula | C47H60O7 |
| Molecular Weight | 736.99 g/mol |
| Exact Mass | 736.43 |
| IUPAC Name | 1,3-bis[4-[2-[3,5-dimethyl-4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]-2,6-dimethylphenoxy]propan-2-ol |
| SMILES | Cc1cc(C(C)(C)c2cc(C)c(OCC3CO3)c(C)c2)cc(C)c1OCC(O)COc1c(C)cc(C(C)(C)c2cc(C)c(OCC3CO3)c(C)c2)cc1C |
| InChI | InChI=1S/C47H60O7/c1-27-13-35(46(9,10)37-17-31(5)44(32(6)18-37)53-25-40-23-49-40)14-28(2)42(27)51-21-39(48)22-52-43-29(3)15-36(16-30(43)4)47(11,12)38-19-33(7)45(34(8)20-38)54-26-41-24-50-41/h13-20,39-41,48H,21-26H2,1-12H3 |
| InChIKey | YMDYPIGVFHOWEE-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.99 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|