C39H36Br8O9 — CID 22603481
1,3-bis[2,6-dibromo-4-[2-[3,5-dibromo-4-(oxiran-2-ylmethoxy)phenoxy]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 22603481) has the molecular formula C39H36Br8O9 and a molecular weight of 1287.94 g/mol. Its IUPAC name is 1,3-bis[2,6-dibromo-4-[2-[3,5-dibromo-4-(oxiran-2-ylmethoxy)phenoxy]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[2,6-dibromo-4-[2-[3,5-dibromo-4-(oxiran-2-ylmethoxy)phenoxy]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 22603481 |
| Molecular Formula | C39H36Br8O9 |
| Molecular Weight | 1287.94 g/mol |
| Exact Mass | 1279.58 |
| IUPAC Name | 1,3-bis[2,6-dibromo-4-[2-[3,5-dibromo-4-(oxiran-2-ylmethoxy)phenoxy]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | CC(C)(Oc1cc(Br)c(OCC2CO2)c(Br)c1)c1cc(Br)c(OCC(O)COc2c(Br)cc(C(C)(C)Oc3cc(Br)c(OCC4CO4)c(Br)c3)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C39H36Br8O9/c1-38(2,55-22-9-30(44)36(31(45)10-22)53-17-24-15-49-24)19-5-26(40)34(27(41)6-19)51-13-21(48)14-52-35-28(42)7-20(8-29(35)43)39(3,4)56-23-11-32(46)37(33(47)12-23)54-18-25-16-50-25/h5-12,21,24-25,48H,13-18H2,1-4H3 |
| InChIKey | RQKBRDGTNTZHBM-UHFFFAOYSA-N |
| XLogP | 12.79 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1287.94 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|