C21H24O7 — CID 59079287
1,3-bis[4-(oxiran-2-ylmethoxy)phenoxy]propan-2-ol (PubChem CID 59079287) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1,3-bis[4-(oxiran-2-ylmethoxy)phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-(oxiran-2-ylmethoxy)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 59079287 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1,3-bis[4-(oxiran-2-ylmethoxy)phenoxy]propan-2-ol |
| SMILES | OC(COc1ccc(OCC2CO2)cc1)COc1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C21H24O7/c22-15(9-23-16-1-5-18(6-2-16)25-11-20-13-27-20)10-24-17-3-7-19(8-4-17)26-12-21-14-28-21/h1-8,15,20-22H,9-14H2 |
| InChIKey | UAZKNDYUWOSHAM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|