C35H36O7 — CID 59660341
1-[4-[[4-(oxetan-3-yloxy)phenyl]methyl]phenoxy]-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol (PubChem CID 59660341) has the molecular formula C35H36O7 and a molecular weight of 568.67 g/mol. Its IUPAC name is 1-[4-[[4-(oxetan-3-yloxy)phenyl]methyl]phenoxy]-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-[4-[[4-(oxetan-3-yloxy)phenyl]methyl]phenoxy]-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 59660341 |
| Molecular Formula | C35H36O7 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.25 |
| IUPAC Name | 1-[4-[[4-(oxetan-3-yloxy)phenyl]methyl]phenoxy]-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol |
| SMILES | OC(COc1ccc(Cc2ccc(OCC3CO3)cc2)cc1)COc1ccc(Cc2ccc(OC3COC3)cc2)cc1 |
| InChI | InChI=1S/C35H36O7/c36-29(19-38-30-9-1-25(2-10-30)17-27-5-13-32(14-6-27)40-23-34-24-41-34)20-39-31-11-3-26(4-12-31)18-28-7-15-33(16-8-28)42-35-21-37-22-35/h1-16,29,34-36H,17-24H2 |
| InChIKey | CHVYTXNQCBKCAC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|