C23H31NO4 — CID 167345215
1-(2-methylpropylamino)-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol (PubChem CID 167345215) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 1-(2-methylpropylamino)-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol.
| Compound Name | 1-(2-methylpropylamino)-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 167345215 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 1-(2-methylpropylamino)-3-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]propan-2-ol |
| SMILES | CC(C)CNCC(O)COc1ccc(Cc2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C23H31NO4/c1-17(2)12-24-13-20(25)14-26-21-7-3-18(4-8-21)11-19-5-9-22(10-6-19)27-15-23-16-28-23/h3-10,17,20,23-25H,11-16H2,1-2H3 |
| InChIKey | SAHGAJNPWRXYJE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|