C37H42O7 — CID 159987730
2-[[4-[(4-methoxyphenyl)methyl]phenoxy]methyl]oxirane;1-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]butan-2-ol (PubChem CID 159987730) has the molecular formula C37H42O7 and a molecular weight of 598.74 g/mol. Its IUPAC name is 2-[[4-[(4-methoxyphenyl)methyl]phenoxy]methyl]oxirane;1-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]butan-2-ol.
| Compound Name | 2-[[4-[(4-methoxyphenyl)methyl]phenoxy]methyl]oxirane;1-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 159987730 |
| Molecular Formula | C37H42O7 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 2-[[4-[(4-methoxyphenyl)methyl]phenoxy]methyl]oxirane;1-[4-[[4-(oxiran-2-ylmethoxy)phenyl]methyl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(Cc2ccc(OCC3CO3)cc2)cc1.COc1ccc(Cc2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C20H24O4.C17H18O3/c1-2-17(21)12-22-18-7-3-15(4-8-18)11-16-5-9-19(10-6-16)23-13-20-14-24-20;1-18-15-6-2-13(3-7-15)10-14-4-8-16(9-5-14)19-11-17-12-20-17/h3-10,17,20-21H,2,11-14H2,1H3;2-9,17H,10-12H2,1H3 |
| InChIKey | OGNXZAMMNPIIEI-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|