C40H50O7 — CID 158947907
4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenol;1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol (PubChem CID 158947907) has the molecular formula C40H50O7 and a molecular weight of 642.83 g/mol. Its IUPAC name is 4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenol;1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol.
| Compound Name | 4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenol;1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 158947907 |
| Molecular Formula | C40H50O7 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | 4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenol;1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]butan-2-ol |
| SMILES | CCC(O)COc1ccc(C(C)(C)c2ccc(OCC3CO3)cc2)cc1.COCCOc1ccc(C(C)(C)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C22H28O4.C18H22O3/c1-4-18(23)13-24-19-9-5-16(6-10-19)22(2,3)17-7-11-20(12-8-17)25-14-21-15-26-21;1-18(2,14-4-8-16(19)9-5-14)15-6-10-17(11-7-15)21-13-12-20-3/h5-12,18,21,23H,4,13-15H2,1-3H3;4-11,19H,12-13H2,1-3H3 |
| InChIKey | JLBAXEMCTOKTAA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|