C41H50O6 — CID 123286390
4-[2-[4-[4-ethyl-2-hydroxy-4-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenol (PubChem CID 123286390) has the molecular formula C41H50O6 and a molecular weight of 638.85 g/mol. Its IUPAC name is 4-[2-[4-[4-ethyl-2-hydroxy-4-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenol.
| Compound Name | 4-[2-[4-[4-ethyl-2-hydroxy-4-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenol |
|---|---|
| PubChem CID | 123286390 |
| Molecular Formula | C41H50O6 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | 4-[2-[4-[4-ethyl-2-hydroxy-4-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]hexoxy]phenyl]propan-2-yl]phenol |
| SMILES | CCC(CC)(CC(O)COc1ccc(C(C)(C)c2ccc(O)cc2)cc1)Oc1ccc(C(C)(C)c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C41H50O6/c1-7-41(8-2,25-34(43)26-44-35-19-11-30(12-20-35)39(3,4)29-9-17-33(42)18-10-29)47-37-23-15-32(16-24-37)40(5,6)31-13-21-36(22-14-31)45-27-38-28-46-38/h9-24,34,38,42-43H,7-8,25-28H2,1-6H3 |
| InChIKey | WQPWNMSSHYQKNR-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|