C24H32O5 — CID 101202882
1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]-3-propoxypropan-2-ol (PubChem CID 101202882) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]-3-propoxypropan-2-ol.
| Compound Name | 1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]-3-propoxypropan-2-ol |
|---|---|
| PubChem CID | 101202882 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenoxy]-3-propoxypropan-2-ol |
| SMILES | CCCOCC(O)COc1ccc(C(C)(C)c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C24H32O5/c1-4-13-26-14-20(25)15-27-21-9-5-18(6-10-21)24(2,3)19-7-11-22(12-8-19)28-16-23-17-29-23/h5-12,20,23,25H,4,13-17H2,1-3H3 |
| InChIKey | DFBDMJUZUJLHOI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|