C38H44O6 — CID 57097261
1-[4-[1-[4-(2-hydroxypropoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]propan-2-ol (PubChem CID 57097261) has the molecular formula C38H44O6 and a molecular weight of 596.76 g/mol. Its IUPAC name is 1-[4-[1-[4-(2-hydroxypropoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]propan-2-ol.
| Compound Name | 1-[4-[1-[4-(2-hydroxypropoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 57097261 |
| Molecular Formula | C38H44O6 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 1-[4-[1-[4-(2-hydroxypropoxy)phenyl]-1-[4-[2-[4-(oxiran-2-ylmethoxy)phenyl]propan-2-yl]phenyl]ethyl]phenoxy]propan-2-ol |
| SMILES | CC(O)COc1ccc(C(C)(c2ccc(OCC(C)O)cc2)c2ccc(C(C)(C)c3ccc(OCC4CO4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H44O6/c1-26(39)22-41-33-18-12-31(13-19-33)38(5,32-14-20-34(21-15-32)42-23-27(2)40)30-8-6-28(7-9-30)37(3,4)29-10-16-35(17-11-29)43-24-36-25-44-36/h6-21,26-27,36,39-40H,22-25H2,1-5H3 |
| InChIKey | MSKPJYXNFBOXJH-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|