C49H48O7 — CID 118685638
1,3-bis[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-phenylethyl]phenoxy]propan-2-ol (PubChem CID 118685638) has the molecular formula C49H48O7 and a molecular weight of 748.92 g/mol. Its IUPAC name is 1,3-bis[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-phenylethyl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-phenylethyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 118685638 |
| Molecular Formula | C49H48O7 |
| Molecular Weight | 748.92 g/mol |
| Exact Mass | 748.34 |
| IUPAC Name | 1,3-bis[4-[1-[4-(oxiran-2-ylmethoxy)phenyl]-1-phenylethyl]phenoxy]propan-2-ol |
| SMILES | CC(c1ccccc1)(c1ccc(OCC(O)COc2ccc(C(C)(c3ccccc3)c3ccc(OCC4CO4)cc3)cc2)cc1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C49H48O7/c1-48(35-9-5-3-6-10-35,39-17-25-44(26-18-39)53-31-46-33-55-46)37-13-21-42(22-14-37)51-29-41(50)30-52-43-23-15-38(16-24-43)49(2,36-11-7-4-8-12-36)40-19-27-45(28-20-40)54-32-47-34-56-47/h3-28,41,46-47,50H,29-34H2,1-2H3 |
| InChIKey | KAYJCDBREQRMNZ-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.92 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|