C33H32O7 — CID 54276038
1,3-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]propan-2-ol (PubChem CID 54276038) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is 1,3-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 54276038 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 1,3-bis[4-[4-(oxiran-2-ylmethoxy)phenyl]phenoxy]propan-2-ol |
| SMILES | OC(COc1ccc(-c2ccc(OCC3CO3)cc2)cc1)COc1ccc(-c2ccc(OCC3CO3)cc2)cc1 |
| InChI | InChI=1S/C33H32O7/c34-27(17-35-28-9-1-23(2-10-28)25-5-13-30(14-6-25)37-19-32-21-39-32)18-36-29-11-3-24(4-12-29)26-7-15-31(16-8-26)38-20-33-22-40-33/h1-16,27,32-34H,17-22H2 |
| InChIKey | RNMMGAXZKQFFGG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|