C39H48O7 — CID 20661045
1,3-bis[4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol (PubChem CID 20661045) has the molecular formula C39H48O7 and a molecular weight of 628.81 g/mol. Its IUPAC name is 1,3-bis[4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol.
| Compound Name | 1,3-bis[4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 20661045 |
| Molecular Formula | C39H48O7 |
| Molecular Weight | 628.81 g/mol |
| Exact Mass | 628.34 |
| IUPAC Name | 1,3-bis[4-[2-[4-(2-methoxyethoxy)phenyl]propan-2-yl]phenoxy]propan-2-ol |
| SMILES | COCCOc1ccc(C(C)(C)c2ccc(OCC(O)COc3ccc(C(C)(C)c4ccc(OCCOC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H48O7/c1-38(2,29-7-15-34(16-8-29)43-25-23-41-5)31-11-19-36(20-12-31)45-27-33(40)28-46-37-21-13-32(14-22-37)39(3,4)30-9-17-35(18-10-30)44-26-24-42-6/h7-22,33,40H,23-28H2,1-6H3 |
| InChIKey | BGKXDXPURWOQQG-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.81 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|