C21H26ClIO4 — CID 145063146
[(2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] hypoiodite (PubChem CID 145063146) has the molecular formula C21H26ClIO4 and a molecular weight of 504.79 g/mol. Its IUPAC name is [(2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] hypoiodite.
| Compound Name | [(2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] hypoiodite |
|---|---|
| PubChem CID | 145063146 |
| Molecular Formula | C21H26ClIO4 |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.06 |
| IUPAC Name | [(2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-hydroxypropyl] hypoiodite |
| SMILES | CC(C)(c1ccc(OCCCCl)cc1)c1ccc(OC[C@H](O)COI)cc1 |
| InChI | InChI=1S/C21H26ClIO4/c1-21(2,16-4-8-19(9-5-16)25-13-3-12-22)17-6-10-20(11-7-17)26-14-18(24)15-27-23/h4-11,18,24H,3,12-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | LBCDJIHKJOSHAS-SFHVURJKSA-N |
| XLogP | 5.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|