C21H24ClF3O3 — CID 121289636
(2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,1,1-trifluoropropan-2-ol (PubChem CID 121289636) has the molecular formula C21H24ClF3O3 and a molecular weight of 416.87 g/mol. Its IUPAC name is (2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,1,1-trifluoropropan-2-ol.
| Compound Name | (2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 121289636 |
| Molecular Formula | C21H24ClF3O3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (2S)-3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(C)(c1ccc(OCCCCl)cc1)c1ccc(OC[C@H](O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H24ClF3O3/c1-20(2,15-4-8-17(9-5-15)27-13-3-12-22)16-6-10-18(11-7-16)28-14-19(26)21(23,24)25/h4-11,19,26H,3,12-14H2,1-2H3/t19-/m0/s1 |
| InChIKey | FWXFZKXTOWEVTR-IBGZPJMESA-N |
| XLogP | 5.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|