C22H26ClF3O2 — CID 162566598
1-(3-chloropropoxy)-4-[2-[4-[(2S)-3,3,3-trifluoro-2-methylpropoxy]phenyl]propan-2-yl]benzene (PubChem CID 162566598) has the molecular formula C22H26ClF3O2 and a molecular weight of 414.90 g/mol. Its IUPAC name is 1-(3-chloropropoxy)-4-[2-[4-[(2S)-3,3,3-trifluoro-2-methylpropoxy]phenyl]propan-2-yl]benzene.
| Compound Name | 1-(3-chloropropoxy)-4-[2-[4-[(2S)-3,3,3-trifluoro-2-methylpropoxy]phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 162566598 |
| Molecular Formula | C22H26ClF3O2 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 1-(3-chloropropoxy)-4-[2-[4-[(2S)-3,3,3-trifluoro-2-methylpropoxy]phenyl]propan-2-yl]benzene |
| SMILES | C[C@@H](COc1ccc(C(C)(C)c2ccc(OCCCCl)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C22H26ClF3O2/c1-16(22(24,25)26)15-28-20-11-7-18(8-12-20)21(2,3)17-5-9-19(10-6-17)27-14-4-13-23/h5-12,16H,4,13-15H2,1-3H3/t16-/m0/s1 |
| InChIKey | UCLJZRQWPSPMGF-INIZCTEOSA-N |
| XLogP | 6.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|