C27H39ClN2O3 — CID 166879142
3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-nitroso-N,N-dipropylpropan-1-amine (PubChem CID 166879142) has the molecular formula C27H39ClN2O3 and a molecular weight of 475.07 g/mol. Its IUPAC name is 3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-nitroso-N,N-dipropylpropan-1-amine.
| Compound Name | 3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-nitroso-N,N-dipropylpropan-1-amine |
|---|---|
| PubChem CID | 166879142 |
| Molecular Formula | C27H39ClN2O3 |
| Molecular Weight | 475.07 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 3-[4-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]-2-nitroso-N,N-dipropylpropan-1-amine |
| SMILES | CCCN(CCC)CC(COc1ccc(C(C)(C)c2ccc(OCCCCl)cc2)cc1)N=O |
| InChI | InChI=1S/C27H39ClN2O3/c1-5-17-30(18-6-2)20-24(29-31)21-33-26-14-10-23(11-15-26)27(3,4)22-8-12-25(13-9-22)32-19-7-16-28/h8-15,24H,5-7,16-21H2,1-4H3 |
| InChIKey | JHLIOGKZHLFPDK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.07 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|