C21H26ClFO2 — CID 121289647
1-(3-chloropropoxy)-4-[2-[4-(3-fluoropropoxy)phenyl]propan-2-yl]benzene (PubChem CID 121289647) has the molecular formula C21H26ClFO2 and a molecular weight of 364.89 g/mol. Its IUPAC name is 1-(3-chloropropoxy)-4-[2-[4-(3-fluoropropoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1-(3-chloropropoxy)-4-[2-[4-(3-fluoropropoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 121289647 |
| Molecular Formula | C21H26ClFO2 |
| Molecular Weight | 364.89 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 1-(3-chloropropoxy)-4-[2-[4-(3-fluoropropoxy)phenyl]propan-2-yl]benzene |
| SMILES | CC(C)(c1ccc(OCCCF)cc1)c1ccc(OCCCCl)cc1 |
| InChI | InChI=1S/C21H26ClFO2/c1-21(2,17-5-9-19(10-6-17)24-15-3-13-22)18-7-11-20(12-8-18)25-16-4-14-23/h5-12H,3-4,13-16H2,1-2H3 |
| InChIKey | XRZYQGPIYURCEX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.89 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|