C21H27ClO3 — CID 123803962
3-[2-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-1-ol (PubChem CID 123803962) has the molecular formula C21H27ClO3 and a molecular weight of 362.90 g/mol. Its IUPAC name is 3-[2-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-1-ol.
| Compound Name | 3-[2-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 123803962 |
| Molecular Formula | C21H27ClO3 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[2-[2-[4-(3-chloropropoxy)phenyl]propan-2-yl]phenoxy]propan-1-ol |
| SMILES | CC(C)(c1ccc(OCCCCl)cc1)c1ccccc1OCCCO |
| InChI | InChI=1S/C21H27ClO3/c1-21(2,17-9-11-18(12-10-17)24-15-5-13-22)19-7-3-4-8-20(19)25-16-6-14-23/h3-4,7-12,23H,5-6,13-16H2,1-2H3 |
| InChIKey | YCVALORPTNQSCD-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|