C22H27ClF2O3 — CID 145063138
1-(3-chloropropoxy)-4-[2-[4-(2,2-difluoro-3-methoxypropoxy)phenyl]propan-2-yl]benzene (PubChem CID 145063138) has the molecular formula C22H27ClF2O3 and a molecular weight of 412.90 g/mol. Its IUPAC name is 1-(3-chloropropoxy)-4-[2-[4-(2,2-difluoro-3-methoxypropoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1-(3-chloropropoxy)-4-[2-[4-(2,2-difluoro-3-methoxypropoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 145063138 |
| Molecular Formula | C22H27ClF2O3 |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-(3-chloropropoxy)-4-[2-[4-(2,2-difluoro-3-methoxypropoxy)phenyl]propan-2-yl]benzene |
| SMILES | COCC(F)(F)COc1ccc(C(C)(C)c2ccc(OCCCCl)cc2)cc1 |
| InChI | InChI=1S/C22H27ClF2O3/c1-21(2,17-5-9-19(10-6-17)27-14-4-13-23)18-7-11-20(12-8-18)28-16-22(24,25)15-26-3/h5-12H,4,13-16H2,1-3H3 |
| InChIKey | CMNLZPXUFGEMGG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|