C19H24O2S2 — CID 154369507
2-[4-[2-[4-(2-sulfanylethoxy)phenyl]propan-2-yl]phenoxy]ethanethiol (PubChem CID 154369507) has the molecular formula C19H24O2S2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 2-[4-[2-[4-(2-sulfanylethoxy)phenyl]propan-2-yl]phenoxy]ethanethiol.
| Compound Name | 2-[4-[2-[4-(2-sulfanylethoxy)phenyl]propan-2-yl]phenoxy]ethanethiol |
|---|---|
| PubChem CID | 154369507 |
| Molecular Formula | C19H24O2S2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 2-[4-[2-[4-(2-sulfanylethoxy)phenyl]propan-2-yl]phenoxy]ethanethiol |
| SMILES | CC(C)(c1ccc(OCCS)cc1)c1ccc(OCCS)cc1 |
| InChI | InChI=1S/C19H24O2S2/c1-19(2,15-3-7-17(8-4-15)20-11-13-22)16-5-9-18(10-6-16)21-12-14-23/h3-10,22-23H,11-14H2,1-2H3 |
| InChIKey | HIGZQLWWMQAPAZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|