C27H36O4 — CID 21116627
1-[2-(2-methylprop-2-enoxy)ethoxy]-4-[2-[4-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]propan-2-yl]benzene (PubChem CID 21116627) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 1-[2-(2-methylprop-2-enoxy)ethoxy]-4-[2-[4-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]propan-2-yl]benzene.
| Compound Name | 1-[2-(2-methylprop-2-enoxy)ethoxy]-4-[2-[4-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 21116627 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 1-[2-(2-methylprop-2-enoxy)ethoxy]-4-[2-[4-[2-(2-methylprop-2-enoxy)ethoxy]phenyl]propan-2-yl]benzene |
| SMILES | C=C(C)COCCOc1ccc(C(C)(C)c2ccc(OCCOCC(=C)C)cc2)cc1 |
| InChI | InChI=1S/C27H36O4/c1-21(2)19-28-15-17-30-25-11-7-23(8-12-25)27(5,6)24-9-13-26(14-10-24)31-18-16-29-20-22(3)4/h7-14H,1,3,15-20H2,2,4-6H3 |
| InChIKey | OUJHIOBJVMUONH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|