C19H22O — CID 139631745
1-(2-methylprop-2-enoxy)-4-(2-phenylpropan-2-yl)benzene (PubChem CID 139631745) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoxy)-4-(2-phenylpropan-2-yl)benzene.
| Compound Name | 1-(2-methylprop-2-enoxy)-4-(2-phenylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 139631745 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-(2-methylprop-2-enoxy)-4-(2-phenylpropan-2-yl)benzene |
| SMILES | C=C(C)COc1ccc(C(C)(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H22O/c1-15(2)14-20-18-12-10-17(11-13-18)19(3,4)16-8-6-5-7-9-16/h5-13H,1,14H2,2-4H3 |
| InChIKey | QSAUSDQTRDORAV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|