C19H24O3 — CID 66741878
ethane-1,2-diol;1-ethenoxy-4-(2-phenylpropan-2-yl)benzene (PubChem CID 66741878) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethane-1,2-diol;1-ethenoxy-4-(2-phenylpropan-2-yl)benzene.
| Compound Name | ethane-1,2-diol;1-ethenoxy-4-(2-phenylpropan-2-yl)benzene |
|---|---|
| PubChem CID | 66741878 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | ethane-1,2-diol;1-ethenoxy-4-(2-phenylpropan-2-yl)benzene |
| SMILES | C=COc1ccc(C(C)(C)c2ccccc2)cc1.OCCO |
| InChI | InChI=1S/C17H18O.C2H6O2/c1-4-18-16-12-10-15(11-13-16)17(2,3)14-8-6-5-7-9-14;3-1-2-4/h4-13H,1H2,2-3H3;3-4H,1-2H2 |
| InChIKey | NRJFEJUOSJYSJH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|