C16H18O3 — CID 134502712
[4-(2-phenylpropan-2-yl)phenoxy]methanediol (PubChem CID 134502712) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenoxy]methanediol.
| Compound Name | [4-(2-phenylpropan-2-yl)phenoxy]methanediol |
|---|---|
| PubChem CID | 134502712 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenoxy]methanediol |
| SMILES | CC(C)(c1ccccc1)c1ccc(OC(O)O)cc1 |
| InChI | InChI=1S/C16H18O3/c1-16(2,12-6-4-3-5-7-12)13-8-10-14(11-9-13)19-15(17)18/h3-11,15,17-18H,1-2H3 |
| InChIKey | ZQLMJKGACPAINO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|