C15H18O3P+ — CID 175105136
trihydroxy-[4-(2-phenylpropan-2-yl)phenyl]phosphanium (PubChem CID 175105136) has the molecular formula C15H18O3P+ and a molecular weight of 277.28 g/mol. Its IUPAC name is trihydroxy-[4-(2-phenylpropan-2-yl)phenyl]phosphanium.
| Compound Name | trihydroxy-[4-(2-phenylpropan-2-yl)phenyl]phosphanium |
|---|---|
| PubChem CID | 175105136 |
| Molecular Formula | C15H18O3P+ |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | trihydroxy-[4-(2-phenylpropan-2-yl)phenyl]phosphanium |
| SMILES | CC(C)(c1ccccc1)c1ccc([P+](O)(O)O)cc1 |
| InChI | InChI=1S/C15H18O3P/c1-15(2,12-6-4-3-5-7-12)13-8-10-14(11-9-13)19(16,17)18/h3-11,16-18H,1-2H3/q+1 |
| InChIKey | ALUDRPVQHIAGNU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|