C33H36O6 — CID 3035140
3-[4-[2-[4-(3-hydroxy-1-phenoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-phenoxypropan-1-ol (PubChem CID 3035140) has the molecular formula C33H36O6 and a molecular weight of 528.65 g/mol. Its IUPAC name is 3-[4-[2-[4-(3-hydroxy-1-phenoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-phenoxypropan-1-ol.
| Compound Name | 3-[4-[2-[4-(3-hydroxy-1-phenoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-phenoxypropan-1-ol |
|---|---|
| PubChem CID | 3035140 |
| Molecular Formula | C33H36O6 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 3-[4-[2-[4-(3-hydroxy-1-phenoxypropoxy)phenyl]propan-2-yl]phenoxy]-3-phenoxypropan-1-ol |
| SMILES | CC(C)(c1ccc(OC(CCO)Oc2ccccc2)cc1)c1ccc(OC(CCO)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H36O6/c1-33(2,25-13-17-29(18-14-25)38-31(21-23-34)36-27-9-5-3-6-10-27)26-15-19-30(20-16-26)39-32(22-24-35)37-28-11-7-4-8-12-28/h3-20,31-32,34-35H,21-24H2,1-2H3 |
| InChIKey | YBWDVHOJEYPZBX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|