C25H36O4 — CID 142891336
3-[4-[2-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]propan-2-yl]phenoxy]-3-methylbutan-1-ol (PubChem CID 142891336) has the molecular formula C25H36O4 and a molecular weight of 400.56 g/mol. Its IUPAC name is 3-[4-[2-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]propan-2-yl]phenoxy]-3-methylbutan-1-ol.
| Compound Name | 3-[4-[2-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]propan-2-yl]phenoxy]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 142891336 |
| Molecular Formula | C25H36O4 |
| Molecular Weight | 400.56 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 3-[4-[2-[4-(4-hydroxy-2-methylbutan-2-yl)oxyphenyl]propan-2-yl]phenoxy]-3-methylbutan-1-ol |
| SMILES | CC(C)(CCO)Oc1ccc(C(C)(C)c2ccc(OC(C)(C)CCO)cc2)cc1 |
| InChI | InChI=1S/C25H36O4/c1-23(2,15-17-26)28-21-11-7-19(8-12-21)25(5,6)20-9-13-22(14-10-20)29-24(3,4)16-18-27/h7-14,26-27H,15-18H2,1-6H3 |
| InChIKey | OZQDZMPTNVSHLC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |