C21H24Br4O2 — CID 67068398
1-(1,1-dibromopropoxy)-4-[2-[4-(1,1-dibromopropoxy)phenyl]propan-2-yl]benzene (PubChem CID 67068398) has the molecular formula C21H24Br4O2 and a molecular weight of 628.04 g/mol. Its IUPAC name is 1-(1,1-dibromopropoxy)-4-[2-[4-(1,1-dibromopropoxy)phenyl]propan-2-yl]benzene.
| Compound Name | 1-(1,1-dibromopropoxy)-4-[2-[4-(1,1-dibromopropoxy)phenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 67068398 |
| Molecular Formula | C21H24Br4O2 |
| Molecular Weight | 628.04 g/mol |
| Exact Mass | 623.85 |
| IUPAC Name | 1-(1,1-dibromopropoxy)-4-[2-[4-(1,1-dibromopropoxy)phenyl]propan-2-yl]benzene |
| SMILES | CCC(Br)(Br)Oc1ccc(C(C)(C)c2ccc(OC(Br)(Br)CC)cc2)cc1 |
| InChI | InChI=1S/C21H24Br4O2/c1-5-20(22,23)26-17-11-7-15(8-12-17)19(3,4)16-9-13-18(14-10-16)27-21(24,25)6-2/h7-14H,5-6H2,1-4H3 |
| InChIKey | VQXDOSMXXYGMAD-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.04 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|