C27H32O2S — CID 71047983
4-[4-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]benzenethiol (PubChem CID 71047983) has the molecular formula C27H32O2S and a molecular weight of 420.62 g/mol. Its IUPAC name is 4-[4-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]benzenethiol.
| Compound Name | 4-[4-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]benzenethiol |
|---|---|
| PubChem CID | 71047983 |
| Molecular Formula | C27H32O2S |
| Molecular Weight | 420.62 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | 4-[4-[2-[4-(3-methylpentan-3-yloxy)phenyl]propan-2-yl]phenoxy]benzenethiol |
| SMILES | CCC(C)(CC)Oc1ccc(C(C)(C)c2ccc(Oc3ccc(S)cc3)cc2)cc1 |
| InChI | InChI=1S/C27H32O2S/c1-6-27(5,7-2)29-24-14-10-21(11-15-24)26(3,4)20-8-12-22(13-9-20)28-23-16-18-25(30)19-17-23/h8-19,30H,6-7H2,1-5H3 |
| InChIKey | TWPWGPGLQFQWDI-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.62 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|