C22H22OS — CID 142069246
4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzenethiol (PubChem CID 142069246) has the molecular formula C22H22OS and a molecular weight of 334.48 g/mol. Its IUPAC name is 4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzenethiol.
| Compound Name | 4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzenethiol |
|---|---|
| PubChem CID | 142069246 |
| Molecular Formula | C22H22OS |
| Molecular Weight | 334.48 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 4-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]benzenethiol |
| SMILES | Cc1ccc(C(C)(C)c2ccc(Oc3ccc(S)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22OS/c1-16-4-6-17(7-5-16)22(2,3)18-8-10-19(11-9-18)23-20-12-14-21(24)15-13-20/h4-15,24H,1-3H3 |
| InChIKey | JTZZXKUULYEKBY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.48 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|