C32H34O2 — CID 118446717
1-methoxy-4-[1-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl]-1-(4-methylphenyl)ethyl]benzene (PubChem CID 118446717) has the molecular formula C32H34O2 and a molecular weight of 450.62 g/mol. Its IUPAC name is 1-methoxy-4-[1-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl]-1-(4-methylphenyl)ethyl]benzene.
| Compound Name | 1-methoxy-4-[1-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl]-1-(4-methylphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 118446717 |
| Molecular Formula | C32H34O2 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 1-methoxy-4-[1-[4-[2-(4-methoxyphenyl)propan-2-yl]phenyl]-1-(4-methylphenyl)ethyl]benzene |
| SMILES | COc1ccc(C(C)(C)c2ccc(C(C)(c3ccc(C)cc3)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34O2/c1-23-7-9-26(10-8-23)32(4,28-17-21-30(34-6)22-18-28)27-13-11-24(12-14-27)31(2,3)25-15-19-29(33-5)20-16-25/h7-22H,1-6H3 |
| InChIKey | VONBANMMJOALAZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|