C32H34 — CID 20734477
1-[1,1-bis(4-methylphenyl)ethyl]-4-[2-(4-methylphenyl)propan-2-yl]benzene (PubChem CID 20734477) has the molecular formula C32H34 and a molecular weight of 418.62 g/mol. Its IUPAC name is 1-[1,1-bis(4-methylphenyl)ethyl]-4-[2-(4-methylphenyl)propan-2-yl]benzene.
| Compound Name | 1-[1,1-bis(4-methylphenyl)ethyl]-4-[2-(4-methylphenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 20734477 |
| Molecular Formula | C32H34 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 1-[1,1-bis(4-methylphenyl)ethyl]-4-[2-(4-methylphenyl)propan-2-yl]benzene |
| SMILES | Cc1ccc(C(C)(C)c2ccc(C(C)(c3ccc(C)cc3)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H34/c1-23-7-13-26(14-8-23)31(4,5)27-19-21-30(22-20-27)32(6,28-15-9-24(2)10-16-28)29-17-11-25(3)12-18-29/h7-22H,1-6H3 |
| InChIKey | BRFRDFVCQYUELO-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|