C33H40 — CID 145481867
ethane;1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene (PubChem CID 145481867) has the molecular formula C33H40 and a molecular weight of 436.68 g/mol. Its IUPAC name is ethane;1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene.
| Compound Name | ethane;1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene |
|---|---|
| PubChem CID | 145481867 |
| Molecular Formula | C33H40 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | ethane;1-methyl-4-(4-methylphenyl)benzene;1-methyl-4-[2-(4-methylphenyl)propan-2-yl]benzene |
| SMILES | CC.Cc1ccc(-c2ccc(C)cc2)cc1.Cc1ccc(C(C)(C)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H20.C14H14.C2H6/c1-13-5-9-15(10-6-13)17(3,4)16-11-7-14(2)8-12-16;1-11-3-7-13(8-4-11)14-9-5-12(2)6-10-14;1-2/h5-12H,1-4H3;3-10H,1-2H3;1-2H3 |
| InChIKey | UEKBUPLJGFCAPI-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |