C45H42O — CID 22978857
bis[4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]phenyl]methanone (PubChem CID 22978857) has the molecular formula C45H42O and a molecular weight of 598.83 g/mol. Its IUPAC name is bis[4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]phenyl]methanone.
| Compound Name | bis[4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 22978857 |
| Molecular Formula | C45H42O |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.32 |
| IUPAC Name | bis[4-[4-[2-(4-methylphenyl)propan-2-yl]phenyl]phenyl]methanone |
| SMILES | Cc1ccc(C(C)(C)c2ccc(-c3ccc(C(=O)c4ccc(-c5ccc(C(C)(C)c6ccc(C)cc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C45H42O/c1-31-7-23-39(24-8-31)44(3,4)41-27-19-35(20-28-41)33-11-15-37(16-12-33)43(46)38-17-13-34(14-18-38)36-21-29-42(30-22-36)45(5,6)40-25-9-32(2)10-26-40/h7-30H,1-6H3 |
| InChIKey | GIJNRXGRVWBKNZ-UHFFFAOYSA-N |
| XLogP | 11.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |