C36H36O3 — CID 118357502
[3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-methylphenyl)methanone (PubChem CID 118357502) has the molecular formula C36H36O3 and a molecular weight of 516.68 g/mol. Its IUPAC name is [3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-methylphenyl)methanone.
| Compound Name | [3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 118357502 |
| Molecular Formula | C36H36O3 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | [3,5-bis(4-tert-butylbenzoyl)phenyl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)c2cc(C(=O)c3ccc(C(C)(C)C)cc3)cc(C(=O)c3ccc(C(C)(C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C36H36O3/c1-23-8-10-24(11-9-23)32(37)27-20-28(33(38)25-12-16-30(17-13-25)35(2,3)4)22-29(21-27)34(39)26-14-18-31(19-15-26)36(5,6)7/h8-22H,1-7H3 |
| InChIKey | STVPGMOHOMNLEI-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |