C20H22O2 — CID 3096610
1-(4-tert-butylphenyl)-3-(4-methylphenyl)propane-1,3-dione (PubChem CID 3096610) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4-methylphenyl)propane-1,3-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4-methylphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 3096610 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4-methylphenyl)propane-1,3-dione |
| SMILES | Cc1ccc(C(=O)CC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22O2/c1-14-5-7-15(8-6-14)18(21)13-19(22)16-9-11-17(12-10-16)20(2,3)4/h5-12H,13H2,1-4H3 |
| InChIKey | MIGOZOUJAOVMKM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|