C39H58N2O2 — CID 159281863
1-tert-butyl-4-methylbenzene;bis(4-tert-butyl-N-propylbenzamide) (PubChem CID 159281863) has the molecular formula C39H58N2O2 and a molecular weight of 586.90 g/mol. Its IUPAC name is 1-tert-butyl-4-methylbenzene;bis(4-tert-butyl-N-propylbenzamide).
| Compound Name | 1-tert-butyl-4-methylbenzene;bis(4-tert-butyl-N-propylbenzamide) |
|---|---|
| PubChem CID | 159281863 |
| Molecular Formula | C39H58N2O2 |
| Molecular Weight | 586.90 g/mol |
| Exact Mass | 586.45 |
| IUPAC Name | 1-tert-butyl-4-methylbenzene;bis(4-tert-butyl-N-propylbenzamide) |
| SMILES | CCCNC(=O)c1ccc(C(C)(C)C)cc1.CCCNC(=O)c1ccc(C(C)(C)C)cc1.Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/2C14H21NO.C11H16/c2*1-5-10-15-13(16)11-6-8-12(9-7-11)14(2,3)4;1-9-5-7-10(8-6-9)11(2,3)4/h2*6-9H,5,10H2,1-4H3,(H,15,16);5-8H,1-4H3 |
| InChIKey | KYZYWAPRXOSIIC-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.90 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |