C19H22O2S — CID 86680885
1-(4-tert-butylphenyl)-3-(2,5-dimethylthiophen-3-yl)propane-1,3-dione (PubChem CID 86680885) has the molecular formula C19H22O2S and a molecular weight of 314.45 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(2,5-dimethylthiophen-3-yl)propane-1,3-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-(2,5-dimethylthiophen-3-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 86680885 |
| Molecular Formula | C19H22O2S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(2,5-dimethylthiophen-3-yl)propane-1,3-dione |
| SMILES | Cc1cc(C(=O)CC(=O)c2ccc(C(C)(C)C)cc2)c(C)s1 |
| InChI | InChI=1S/C19H22O2S/c1-12-10-16(13(2)22-12)18(21)11-17(20)14-6-8-15(9-7-14)19(3,4)5/h6-10H,11H2,1-5H3 |
| InChIKey | MXOJOHFIIMKIIX-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|