C19H20O4 — CID 139685482
1-(4-tert-butyl-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione (PubChem CID 139685482) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is 1-(4-tert-butyl-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione.
| Compound Name | 1-(4-tert-butyl-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 139685482 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-(4-tert-butyl-2-hydroxyphenyl)-3-(4-hydroxyphenyl)propane-1,3-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)CC(=O)c2ccc(O)cc2)c(O)c1 |
| InChI | InChI=1S/C19H20O4/c1-19(2,3)13-6-9-15(17(22)10-13)18(23)11-16(21)12-4-7-14(20)8-5-12/h4-10,20,22H,11H2,1-3H3 |
| InChIKey | KJUMZRBWXQLPSL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|