C20H22O4 — CID 877592
1-(4-tert-butylphenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione (PubChem CID 877592) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione.
| Compound Name | 1-(4-tert-butylphenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione |
|---|---|
| PubChem CID | 877592 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(2-hydroxy-5-methoxyphenyl)propane-1,3-dione |
| SMILES | COc1ccc(O)c(C(=O)CC(=O)c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C20H22O4/c1-20(2,3)14-7-5-13(6-8-14)18(22)12-19(23)16-11-15(24-4)9-10-17(16)21/h5-11,21H,12H2,1-4H3 |
| InChIKey | HXPFPZVBPXBBRN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|