C36H44O6 — CID 68723546
1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate (PubChem CID 68723546) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate.
| Compound Name | 1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate |
|---|---|
| PubChem CID | 68723546 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-(4-methoxyphenyl)propane-1,3-dione;(3,3,5-trimethylcyclohexyl) 2-hydroxybenzoate |
| SMILES | CC1CC(OC(=O)c2ccccc2O)CC(C)(C)C1.COc1ccc(C(=O)CC(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H22O3.C16H22O3/c1-20(2,3)16-9-5-14(6-10-16)18(21)13-19(22)15-7-11-17(23-4)12-8-15;1-11-8-12(10-16(2,3)9-11)19-15(18)13-6-4-5-7-14(13)17/h5-12H,13H2,1-4H3;4-7,11-12,17H,8-10H2,1-3H3 |
| InChIKey | DWMVLYAYMVLZSD-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|