C20H30O3 — CID 173265224
(3,3,5-trimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate (PubChem CID 173265224) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3,3,5-trimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate.
| Compound Name | (3,3,5-trimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265224 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3,3,5-trimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate |
| SMILES | CC1CC(OOC(=O)c2ccc(C(C)(C)C)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C20H30O3/c1-14-11-17(13-20(5,6)12-14)22-23-18(21)15-7-9-16(10-8-15)19(2,3)4/h7-10,14,17H,11-13H2,1-6H3 |
| InChIKey | HXQUYADTKZVQTE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|