C19H28O3 — CID 173265879
(2,5-dimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate (PubChem CID 173265879) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2,5-dimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate.
| Compound Name | (2,5-dimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173265879 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2,5-dimethylcyclohexyl) 4-tert-butylbenzenecarboperoxoate |
| SMILES | CC1CCC(C)C(OOC(=O)c2ccc(C(C)(C)C)cc2)C1 |
| InChI | InChI=1S/C19H28O3/c1-13-6-7-14(2)17(12-13)21-22-18(20)15-8-10-16(11-9-15)19(3,4)5/h8-11,13-14,17H,6-7,12H2,1-5H3 |
| InChIKey | CMXBBKNMTQVKSK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|