C18H28O3Si — CID 173267680
(3,4-dimethylcyclohexyl) 4-trimethylsilylbenzenecarboperoxoate (PubChem CID 173267680) has the molecular formula C18H28O3Si and a molecular weight of 320.50 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl) 4-trimethylsilylbenzenecarboperoxoate.
| Compound Name | (3,4-dimethylcyclohexyl) 4-trimethylsilylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173267680 |
| Molecular Formula | C18H28O3Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (3,4-dimethylcyclohexyl) 4-trimethylsilylbenzenecarboperoxoate |
| SMILES | CC1CCC(OOC(=O)c2ccc([Si](C)(C)C)cc2)CC1C |
| InChI | InChI=1S/C18H28O3Si/c1-13-6-9-16(12-14(13)2)20-21-18(19)15-7-10-17(11-8-15)22(3,4)5/h7-8,10-11,13-14,16H,6,9,12H2,1-5H3 |
| InChIKey | ADSLZLBAXQEPAG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|