C19H26O3Si — CID 173265914
(2-methylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate (PubChem CID 173265914) has the molecular formula C19H26O3Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (2-methylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate.
| Compound Name | (2-methylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173265914 |
| Molecular Formula | C19H26O3Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2-methylcyclohexyl) 4-[bis(ethenyl)-methylsilyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C)(C=C)c1ccc(C(=O)OOC2CCCCC2C)cc1 |
| InChI | InChI=1S/C19H26O3Si/c1-5-23(4,6-2)17-13-11-16(12-14-17)19(20)22-21-18-10-8-7-9-15(18)3/h5-6,11-15,18H,1-2,7-10H2,3-4H3 |
| InChIKey | HTUGTKSGWGVFCA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|