About (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate
(2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate (PubChem CID 173267973) has the molecular formula C21H32O3Si
and a molecular weight of 360.57 g/mol. Its IUPAC name is (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate.
Molecular Properties
| Compound Name | (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate |
| PubChem CID | 173267973 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C)(C)c1ccc(C(=O)OOC2CCCCC2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32O3Si/c1-7-25(5,6)17-14-12-16(13-15-17)20(22)24-23-19-11-9-8-10-18(19)21(2,3)4/h7,12-15,18-19H,1,8-11H2,2-6H3 |
| InChIKey | VWRFVSYKCKTDLM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate?
The IUPAC name of (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate (CID 173267973) is (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate.
What is the SMILES notation for (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate?
The canonical SMILES for (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate is C=C[Si](C)(C)c1ccc(C(=O)OOC2CCCCC2C(C)(C)C)cc1.
What is the InChIKey of (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate?
The InChIKey is VWRFVSYKCKTDLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H32O3Si/c1-7-25(5,6)17-14-12-16(13-15-17)20(22)24-23-19-11-9-8-10-18(19)21(2,3)4/h7,12-15,18-19H,1,8-11H2,2-6H3.
What are the key properties of (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate?
(2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate has a molecular weight of 360.57 g/mol, XLogP of 5.02, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate is sourced from PubChem (CID 173267973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).