C21H32O3Si — CID 173267973
(2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate (PubChem CID 173267973) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate.
| Compound Name | (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173267973 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2-tert-butylcyclohexyl) 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C)(C)c1ccc(C(=O)OOC2CCCCC2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H32O3Si/c1-7-25(5,6)17-14-12-16(13-15-17)20(22)24-23-19-11-9-8-10-18(19)21(2,3)4/h7,12-15,18-19H,1,8-11H2,2-6H3 |
| InChIKey | VWRFVSYKCKTDLM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|