C31H44O8Si2 — CID 173265787
[1-[4-[ethenyl(dimethyl)silyl]benzoyl]peroxy-3-(3-propoxypropoxy)propyl] 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate (PubChem CID 173265787) has the molecular formula C31H44O8Si2 and a molecular weight of 600.86 g/mol. Its IUPAC name is [1-[4-[ethenyl(dimethyl)silyl]benzoyl]peroxy-3-(3-propoxypropoxy)propyl] 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate.
| Compound Name | [1-[4-[ethenyl(dimethyl)silyl]benzoyl]peroxy-3-(3-propoxypropoxy)propyl] 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate |
|---|---|
| PubChem CID | 173265787 |
| Molecular Formula | C31H44O8Si2 |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 600.26 |
| IUPAC Name | [1-[4-[ethenyl(dimethyl)silyl]benzoyl]peroxy-3-(3-propoxypropoxy)propyl] 4-[ethenyl(dimethyl)silyl]benzenecarboperoxoate |
| SMILES | C=C[Si](C)(C)c1ccc(C(=O)OOC(CCOCCCOCCC)OOC(=O)c2ccc([Si](C)(C)C=C)cc2)cc1 |
| InChI | InChI=1S/C31H44O8Si2/c1-8-21-34-22-11-23-35-24-20-29(36-38-30(32)25-12-16-27(17-13-25)40(4,5)9-2)37-39-31(33)26-14-18-28(19-15-26)41(6,7)10-3/h9-10,12-19,29H,2-3,8,11,20-24H2,1,4-7H3 |
| InChIKey | IOUOGKILDOFMHW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|