C26H34O7 — CID 173266310
[1-(4-propan-2-ylbenzoyl)peroxy-3-propoxypropyl] 4-propan-2-ylbenzenecarboperoxoate (PubChem CID 173266310) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol. Its IUPAC name is [1-(4-propan-2-ylbenzoyl)peroxy-3-propoxypropyl] 4-propan-2-ylbenzenecarboperoxoate.
| Compound Name | [1-(4-propan-2-ylbenzoyl)peroxy-3-propoxypropyl] 4-propan-2-ylbenzenecarboperoxoate |
|---|---|
| PubChem CID | 173266310 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [1-(4-propan-2-ylbenzoyl)peroxy-3-propoxypropyl] 4-propan-2-ylbenzenecarboperoxoate |
| SMILES | CCCOCCC(OOC(=O)c1ccc(C(C)C)cc1)OOC(=O)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C26H34O7/c1-6-16-29-17-15-24(30-32-25(27)22-11-7-20(8-12-22)18(2)3)31-33-26(28)23-13-9-21(10-14-23)19(4)5/h7-14,18-19,24H,6,15-17H2,1-5H3 |
| InChIKey | VWPGOSFTRPTAHP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|